Fluridone structure
|
Common Name | Fluridone | ||
|---|---|---|---|---|
| CAS Number | 59756-60-4 | Molecular Weight | 329.316 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 444.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H14F3NO | Melting Point | 154-155°C | |
| MSDS | Chinese USA | Flash Point | 222.6±28.7 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
Use of FluridoneFluridone is an inhibitor of abscisic acid (ABA) biosynthesis. Fluridone suppresses the expression of AchnFAR and TF genes and reduces the formation of primary alcohols[1]. |
| Name | fluridone |
|---|---|
| Synonym | More Synonyms |
| Description | Fluridone is an inhibitor of abscisic acid (ABA) biosynthesis. Fluridone suppresses the expression of AchnFAR and TF genes and reduces the formation of primary alcohols[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 444.4±45.0 °C at 760 mmHg |
| Melting Point | 154-155°C |
| Molecular Formula | C19H14F3NO |
| Molecular Weight | 329.316 |
| Flash Point | 222.6±28.7 °C |
| Exact Mass | 329.102753 |
| PSA | 22.00000 |
| LogP | 3.70 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | YWBVHLJPRPCRSD-UHFFFAOYSA-N |
| SMILES | Cn1cc(-c2ccccc2)c(=O)c(-c2cccc(C(F)(F)F)c2)c1 |
| Storage condition | 0-6°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H311-H411 |
| Precautionary Statements | P273-P280-P312 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves |
| Hazard Codes | N:Dangerousfortheenvironment; |
| Risk Phrases | R51/53 |
| Safety Phrases | S60-S36/37 |
| RIDADR | UN 3077 |
| RTECS | UU7786500 |
| Packaging Group | III |
|
~95%
Fluridone CAS#:59756-60-4 |
| Literature: Eli Lilly and Company Patent: US4152136 A1, 1979 ; |
|
~%
Fluridone CAS#:59756-60-4 |
| Literature: US4235619 A1, ; |
|
~%
Detail
|
| Literature: US4152136 A1, ; |
|
Genotoxic and cytotoxic evaluation of the herbicide flurochloridone on Chinese hamster ovary (CHO-K1) cells.
Toxicol. In Vitro 26(1) , 157-63, (2012) The in vitro effects of flurochloridone (FLC) and its formulations Twin Gold Pack® (25% a.i.) and Rainbow® (25% a.i.) were evaluated on Chinese hamster ovary (CHO-K1) cells by genotoxicity [sister chr... |
|
|
Adsorption of diuron, fluridone and norflurazon on single-walled and multi-walled carbon nanotubes.
Sci. Total Environ. 439 , 1-7, (2012) The sorption behaviors of diuron (DIU), fluridone (FLU) and norflurazon (NOR) by a single-walled carbon nanotube (SWCNT) and three multi-walled carbon nanotubes (MWCNT) samples including MWCNT10 (<10n... |
|
|
Sorption of fluorinated herbicides to plant biomass-derived biochars as a function of molecular structure.
Bioresour. Technol. 102(21) , 9897-903, (2011) Biochars produced at different heat treatment temperatures (HTT) are molecularly distinct and thus expected to show variable sorbent characteristics. We investigated the difference in sorption behavio... |
| 1-Methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-4(1H)-one |
| 1-Methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]-4(1H)-pyridinone |
| 1-methyl-3-phenyl-5-(α,α,α-trifluoro-m-tolyl)-4-pyridone |
| Fluridone |
| Sonar |
| 4(1H)-Pyridinone, 1-methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]- |
| Fluridon |
| Sonar X |
| 1-methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one |
| 1-Methyl-3-phenyl-5-(a,a,a-trifluoro-m-tolyl)-4-pyridone |
| MFCD00078682 |
| Pride |
| EINECS 261-916-6 |
| Brake |
| 1-Methyl-3-phenyl-5-[3-(trifluormethyl)phenyl]pyridin-4(1H)-on |