2-[(E)-2-nitroprop-1-enyl]naphthalene structure
|
Common Name | 2-[(E)-2-nitroprop-1-enyl]naphthalene | ||
|---|---|---|---|---|
| CAS Number | 59832-12-1 | Molecular Weight | 213.23200 | |
| Density | 1.203g/cm3 | Boiling Point | 371.6ºC at 760 mmHg | |
| Molecular Formula | C13H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.2ºC | |
| Name | 1-nitro-1-methyl-2-naphtylethene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 371.6ºC at 760 mmHg |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.23200 |
| Flash Point | 178.2ºC |
| Exact Mass | 213.07900 |
| PSA | 45.82000 |
| LogP | 4.00050 |
| Index of Refraction | 1.666 |
| InChIKey | DTZVIBZSHDZFPP-NTMALXAHSA-N |
| SMILES | CC(=Cc1ccc2ccccc2c1)[N+](=O)[O-] |
| Storage condition | 2-8°C |
|
~84%
2-[(E)-2-nitrop... CAS#:59832-12-1 |
| Literature: Foucaud, Andre; Razorilalana-Rabearivony, Claudia; Loukakou, Emile; Person, Herve Journal of Organic Chemistry, 1983 , vol. 48, # 21 p. 3639 - 3644 |
| 1-<2>Naphthyl-2-nitro-prop-1-en |
| 2-<2-Nitro-propenyl>-naphthalin |