Levomepromazine structure
|
Common Name | Levomepromazine | ||
|---|---|---|---|---|
| CAS Number | 60-99-1 | Molecular Weight | 328.47200 | |
| Density | 1.125g/cm3 | Boiling Point | 468ºC at 760 mmHg | |
| Molecular Formula | C19H24N2OS | Melting Point | 117°C | |
| MSDS | N/A | Flash Point | 236.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of LevomepromazineMethotrimeprazine (Levomepromazine) is an orally available neuroleptic agent, which is commonly used to relieve nausea and vomiting in palliative care settings. Levomepromazine has antagonist actions at multiple neurotransmitter receptor sites, including dopaminergic, cholinergic, serotonin and histamine receptors[1]. |
| Name | methotrimeprazine |
|---|---|
| Synonym | More Synonyms |
| Description | Methotrimeprazine (Levomepromazine) is an orally available neuroleptic agent, which is commonly used to relieve nausea and vomiting in palliative care settings. Levomepromazine has antagonist actions at multiple neurotransmitter receptor sites, including dopaminergic, cholinergic, serotonin and histamine receptors[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.125g/cm3 |
|---|---|
| Boiling Point | 468ºC at 760 mmHg |
| Melting Point | 117°C |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.47200 |
| Flash Point | 236.8ºC |
| Exact Mass | 328.16100 |
| PSA | 41.01000 |
| LogP | 4.56060 |
| Index of Refraction | 1.594 |
| InChIKey | VRQVVMDWGGWHTJ-CQSZACIVSA-N |
| SMILES | COc1ccc2c(c1)N(CC(C)CN(C)C)c1ccccc1S2 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332 |
| Precautionary Statements | P261-P280-P301 + P312 + P330 |
| Hazard Codes | Xn |
| Risk Phrases | R20/21/22 |
| Safety Phrases | 36 |
| RIDADR | UN 3249 |
| RTECS | SO6125000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2934300000 |
|
~%
Levomepromazine CAS#:60-99-1 |
| Literature: US2837518 , ; |
|
~%
Levomepromazine CAS#:60-99-1 |
| Literature: US2837518 , ; |
|
~%
Levomepromazine CAS#:60-99-1 |
| Literature: US2837518 , ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (-)-10-(3-[DIMETHYLAMINO]-2-METHYLPROPYL)-2-METHOXY-PHENOTHIAZINE MALEATE SALT |
| milezin |
| Nirvan |
| Levomepromazine |
| dedoran |
| XP 03 |
| rp7044 |
| nomizan |