2-Amino-4-chloro-6-nitrophenol structure
|
Common Name | 2-Amino-4-chloro-6-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 6358-08-3 | Molecular Weight | 188.568 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 308.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C6H5ClN2O3 | Melting Point | 158-162 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 140.2±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Amino-4-chloro-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 308.3±42.0 °C at 760 mmHg |
| Melting Point | 158-162 °C(lit.) |
| Molecular Formula | C6H5ClN2O3 |
| Molecular Weight | 188.568 |
| Flash Point | 140.2±27.9 °C |
| Exact Mass | 187.998871 |
| PSA | 92.07000 |
| LogP | 2.69 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | MHAFRUMLQZZSIN-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)cc([N+](=O)[O-])c1O |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922299090 |
|
~92%
2-Amino-4-chlor... CAS#:6358-08-3 |
| Literature: Eijgendaal, Irene; Klein, Gerrit; Terhorst-Van Amstel, Maria J.L.; Zwier, Klaas; Bruins, Nico; Rigter, Hendrikus T.; Gout, Erik Patent: US2006/40932 A1, 2006 ; Location in patent: Page/Page column 4-5 ; |
|
~%
2-Amino-4-chlor... CAS#:6358-08-3 |
| Literature: DE234742 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 136 |
|
~%
2-Amino-4-chlor... CAS#:6358-08-3 |
| Literature: DE234742 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 136 |
|
~%
2-Amino-4-chlor... CAS#:6358-08-3 |
| Literature: DE147060 ; |
|
~%
2-Amino-4-chlor... CAS#:6358-08-3 |
| Literature: DE186655 ; |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-4-chloro-6-nitrophenol |
| 6-amino-4-chloro-2-nitrophenol |
| MFCD00035925 |
| 6-Nitro-4-chloro-2-aminophenol |
| 4-chloro-6-nitro-2-aminophenol |
| 2-amino-4-chloro-6-nitro-phenol |
| EINECS 228-761-6 |
| 2,6 DICHLORO-4-METHYL-3-PYRIDINE CARBONITRILE |
| 2-Amino-4-chlor-6-nitro-phenol |
| Phenol, 2-amino-4-chloro-6-nitro- |
| 1-amino-2-hydroxy-3-nitro-5-chlorobenzene |