1-Boc-3-Hydroxymethyl-5-methoxyindole structure
|
Common Name | 1-Boc-3-Hydroxymethyl-5-methoxyindole | ||
|---|---|---|---|---|
| CAS Number | 600136-09-2 | Molecular Weight | 277.31600 | |
| Density | 1.169g/cm3 | Boiling Point | 430.705ºC at 760 mmHg | |
| Molecular Formula | C15H19NO4 | Melting Point | 137-139ºC | |
| MSDS | N/A | Flash Point | 214.283ºC | |
| Name | 1-Boc-3-Hydroxymethyl-5-methoxyindole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 430.705ºC at 760 mmHg |
| Melting Point | 137-139ºC |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.31600 |
| Flash Point | 214.283ºC |
| Exact Mass | 277.13100 |
| PSA | 60.69000 |
| LogP | 2.92540 |
| Index of Refraction | 1.543 |
| InChIKey | OYKYYDIURXPHSS-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)c(CO)cn2C(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-Butyl 3-(hydroxymethyl)-5-methoxy-1H-indole-1-carboxylate |