2-Hydroxy-6-nitrobenzoic acid structure
|
Common Name | 2-Hydroxy-6-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 601-99-0 | Molecular Weight | 183.11800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Hydroxy-6-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H5NO5 |
|---|---|
| Molecular Weight | 183.11800 |
| Exact Mass | 183.01700 |
| PSA | 103.35000 |
| LogP | 1.52180 |
| InChIKey | QICHZWUWPVMQTD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(O)cccc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918290000 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 2-hydroxy-6-nitro-benzoic acid |
| Benzoic acid,2-hydroxy-6-nitro |
| 6-Nitrosalicylsaeure |
| 2-Hydroxy-6-nitro-benzoesaeure |