2-Bromo-6-nitrobenzoic acid structure
|
Common Name | 2-Bromo-6-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 38876-67-4 | Molecular Weight | 246.015 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 365.3±32.0 °C at 760 mmHg | |
| Molecular Formula | C7H4BrNO4 | Melting Point | 177-178ºC | |
| MSDS | N/A | Flash Point | 174.7±25.1 °C | |
| Name | 2-Bromo-6-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.3±32.0 °C at 760 mmHg |
| Melting Point | 177-178ºC |
| Molecular Formula | C7H4BrNO4 |
| Molecular Weight | 246.015 |
| Flash Point | 174.7±25.1 °C |
| Exact Mass | 244.932358 |
| PSA | 83.12000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | KWNBOCMNFKJJCK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(Br)cccc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
|
~40%
2-Bromo-6-nitro... CAS#:38876-67-4 |
| Literature: Glossop, Steve C. Synthesis, 2007 , # 7 p. 981 - 983 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Brom-6-nitro-benzoesaeure |
| Benzoic acid,2-bromo-6-nitro |
| 2-bromanyl-6-nitro-benzoic acid |
| Benzoic acid, 2-bromo-6-nitro- |
| 2-Bromo-6-nitrobenzoicacid |
| 2-Bromo-6-nitrobenzoic acid |