beta-lipotropin (60-65) structure
|
Common Name | beta-lipotropin (60-65) | ||
|---|---|---|---|---|
| CAS Number | 60117-19-3 | Molecular Weight | 729.84700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H47N9O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of beta-lipotropin (60-65)β-Lipotropin (60-65) (β-LPH (60-65)), an opioid peptide, is a potent opioid agonist[1]. |
| Name | (2S)-2-[[(2S)-2-[[2-[[2-[[(2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|
| Description | β-Lipotropin (60-65) (β-LPH (60-65)), an opioid peptide, is a potent opioid agonist[1]. |
|---|---|
| Related Catalog | |
| In Vitro | β-Lipotropin (61-69) (β-LPH (60-65)) shows comparable opioid agonist potency with that of enkephalin in binding assays on synaptosomal plasma membrane[1]. |
| References |
| Molecular Formula | C33H47N9O8S |
|---|---|
| Molecular Weight | 729.84700 |
| Exact Mass | 729.32700 |
| PSA | 333.70000 |
| LogP | 4.38520 |
| InChIKey | PVNNAAWVJPIJHS-CQJMVLFOSA-N |
| SMILES | CSCCC(NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CCCN=C(N)N)C(=O)O |