Corypalmine structure
|
Common Name | Corypalmine | ||
|---|---|---|---|---|
| CAS Number | 6018-40-2 | Molecular Weight | 341.401 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 501.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.9±30.1 °C | |
Use of Corypalmine(-)-Corypalmine (Discretinine), an alkaloid that could be isolated from the stem of Guatteriopsis friesiana, possesses antimicrobial activity[1]. |
| Name | (+)-corypalmine |
|---|---|
| Synonym | More Synonyms |
| Description | (-)-Corypalmine (Discretinine), an alkaloid that could be isolated from the stem of Guatteriopsis friesiana, possesses antimicrobial activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 501.2±50.0 °C at 760 mmHg |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.401 |
| Flash Point | 256.9±30.1 °C |
| Exact Mass | 341.162720 |
| PSA | 51.16000 |
| LogP | 2.93 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.640 |
| InChIKey | BMCZTYDZHNTKPR-INIZCTEOSA-N |
| SMILES | COc1cc2c(cc1O)CCN1Cc3c(ccc(OC)c3OC)CC21 |
| Hazard Codes | Xi |
|---|
| d,l-Corypalmin |
| 3-Hydroxy-2,9,10-trimethoxyberbine |
| Tetrahydrojateorrhizine |
| corypalmine |
| 5,8,13,13a-Tetrahydro-2,9,10-trimethoxy-6H-dibenzo[a,g]quinolizin-3-ol |
| 2,9,10-Trimethoxy-5,8,13,13a-tetrahydro-6H-isoquino[3,2-a]isoquinolin-3-ol |
| Tetrahydrojatrorrhizine |
| dl-Corypalmine |
| 2,9,10-Trimethoxyberbin-3-ol |
| 2,9,10-Trimethoxy-5,8,13,13a-tetrahydro-6H-isoquinolino[3,2-a]isoquinolin-3-ol |
| dl-Tetrahydrojatrorrhizine |
| Tetrahydrojatrorrhin |
| 2,9,10-trimethoxy-berbin-3-ol |
| rac-2,9,10-trimethoxy-berbin-3-ol |