(Des-Tyr1)-Leu-Enkephalin structure
|
Common Name | (Des-Tyr1)-Leu-Enkephalin | ||
|---|---|---|---|---|
| CAS Number | 60254-83-3 | Molecular Weight | 392.449 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 784.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C19H28N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 428.3±32.9 °C | |
| Name | D Leu-Enkephalin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 784.6±60.0 °C at 760 mmHg |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.449 |
| Flash Point | 428.3±32.9 °C |
| Exact Mass | 392.205963 |
| PSA | 150.62000 |
| LogP | 1.29 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | OCMQTALHBUOBFN-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CN)C(=O)O |
| HS Code | 2924299090 |
|---|
|
~%
(Des-Tyr1)-Leu-... CAS#:60254-83-3 |
| Literature: Shai, Yechiel; Jacobson, Kenneth A.; Patchornik, Abraham Journal of the American Chemical Society, 1985 , vol. 107, # 14 p. 4249 - 4252 |
|
~%
(Des-Tyr1)-Leu-... CAS#:60254-83-3 |
| Literature: Dass, Chhabil; Mahalakshmi Life Sciences, 1996 , vol. 58, # 13 p. 1039 - 1045 |
|
~%
Detail
|
| Literature: Sayani; Chun; Chien Journal of Pharmaceutical Sciences, 1993 , vol. 82, # 11 p. 1179 - 1185 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| H-GLY-GLY-PHE-LEU-OH |
| [des-tyr1]-leucine enkephalin |
| des-Tyr-leucine enkephalin |
| des-Tyr-Leu-enkephalin |
| ENKEPHALIN (DES TYR2,LEU4) |
| H-Gly-Gly-L-Phe-L-Leu-OH |
| des-tyr(1)-enkephalin-le |
| GLY-GLY-PHE-LEU |
| Glycylglycyl-L-phenylalanyl-L-leucine |
| enkephalin-Leu,des-Tyr(1) |
| [DES-TYR1,LEU5]-ENKEPHALIN |
| (DES-TYR1)-LEU-ENKEPHALIN |
| L-Leucine, glycylglycyl-L-phenylalanyl- |