Diethyl nitromalonate structure
|
Common Name | Diethyl nitromalonate | ||
|---|---|---|---|---|
| CAS Number | 603-67-8 | Molecular Weight | 205.165 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 287.5±0.0 °C at 760 mmHg | |
| Molecular Formula | C7H11NO6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 102.6±23.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Diethyl 2-nitromalonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 287.5±0.0 °C at 760 mmHg |
| Molecular Formula | C7H11NO6 |
| Molecular Weight | 205.165 |
| Flash Point | 102.6±23.8 °C |
| Exact Mass | 205.058640 |
| PSA | 98.42000 |
| LogP | 2.34 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | DAKKWKYIQGMKOS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917190090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
A New Synthetic Method of Alkyl Carbonocyanidate iV-Oxides. SHiMizu T, et al.
Bull. Chem. Soc. Jpn. 58 , 2519-22, (1985)
|
|
|
Synthesis and structure of 5, 5-diethoxycarbonyl-1-pyrroline< i> N</i>-oxide (DECPO). Application to superoxide radical trapping. Karoui H, et al.
Tetrahedron Lett. 45(1) , 149-52, (2004)
|
| Propanedioic acid, 2-nitro-, diethyl ester |
| EINECS 210-052-8 |
| MFCD00009142 |
| Diethyl nitromalonate |
| Propanedioic acid, nitro-, diethyl ester |
| diethyl 2-nitropropanedioate |