1-Ethyl-4-methylquinolinium iodide structure
|
Common Name | 1-Ethyl-4-methylquinolinium iodide | ||
|---|---|---|---|---|
| CAS Number | 605-59-4 | Molecular Weight | 299.15100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14IN | Melting Point | 143-146ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-ethyl-4-methylquinolin-1-ium,iodide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 143-146ºC(lit.) |
|---|---|
| Molecular Formula | C12H14IN |
| Molecular Weight | 299.15100 |
| Exact Mass | 299.01700 |
| PSA | 3.88000 |
| InChIKey | VQDKCFLPUPEBJC-UHFFFAOYSA-M |
| SMILES | CC[n+]1ccc(C)c2ccccc21.[I-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
|
~70%
1-Ethyl-4-methy... CAS#:605-59-4 |
| Literature: Winstead, Angela J.; Nyambura, Grace; Matthews, Rachael; Toney, Deveine; Oyaghire, Stanley Molecules, 2013 , vol. 18, # 11 p. 14306 - 14319 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 1-Ethyllepidinium iodide |
| Lepidinium ethiodide |
| 1-Ethyl-4-methylquinolinium iodide |
| MFCD00192160 |
| N-ethyl-4-methylquinolinium iodide |
| 4-methyl-1-ethylquinolinium iodide |
| 1-Ethyl-lepidinium-iodid |
| 4-Methylquinoline ethiodide |
| 1-ethyl-4-methylquinolin-1-ium iodide |
| Lepidine ethiodide |