1,1′-Diethyl-4,4′-cyanine iodide structure
|
Common Name | 1,1′-Diethyl-4,4′-cyanine iodide | ||
|---|---|---|---|---|
| CAS Number | 4727-49-5 | Molecular Weight | 454.34700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H23IN2 | Melting Point | 280℃ (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 1,1′-Diethyl-4,4′-cyanine iodide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 280℃ (dec.)(lit.) |
|---|---|
| Molecular Formula | C23H23IN2 |
| Molecular Weight | 454.34700 |
| Exact Mass | 454.09100 |
| PSA | 8.81000 |
| LogP | 1.23570 |
| InChIKey | BFVPXROCOCTNOP-UHFFFAOYSA-M |
| SMILES | CCN1C=CC(=Cc2cc[n+](CC)c3ccccc23)c2ccccc21.[I-] |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H315-H319-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | 23/24/25-36/37/38 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
|
~%
1,1′-Diethyl-4,... CAS#:4727-49-5 |
| Literature: Sugimoto Kagaku Kenkyusho Hokoku, 1951 , vol. 27, p. 262,266 Chem.Abstr., 1952 , p. 9456 |
|
~%
1,1′-Diethyl-4,... CAS#:4727-49-5 |
| Literature: Ogata Proceedings of the Japan Academy, 1949 , vol. 25, # 11 p. 17 Chem.Abstr., 1952 , p. 3451 Full Text Show Details Ogata Nippon Shashin Gakkaishi, 1950 , vol. 13, p. 52,53 Chem.Abstr., 1952 , p. 6531 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,1'-diethyl-4,4'-cyanine iodide |
| MFCD00151338 |
| EINECS 225-223-2 |