Etheno-2'-deoxy-β-D-adenosine 5'-Monophosphate structure
|
Common Name | Etheno-2'-deoxy-β-D-adenosine 5'-Monophosphate | ||
|---|---|---|---|---|
| CAS Number | 60508-81-8 | Molecular Weight | 355.24300 | |
| Density | 2.08g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H14N5O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Etheno-2'-deoxy-β-D-adenosine 5'-Monophosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 2.08g/cm3 |
|---|---|
| Molecular Formula | C12H14N5O6P |
| Molecular Weight | 355.24300 |
| Exact Mass | 355.06800 |
| PSA | 154.04000 |
| Index of Refraction | 1.878 |
| InChIKey | CACCSKNYAUKFAV-DJLDLDEBSA-N |
| SMILES | O=P(O)(O)OCC1OC(n2cnc3c2ncn2ccnc32)CC1O |
|
~97%
Etheno-2'-deoxy... CAS#:60508-81-8 |
| Literature: Flaherty; Balse; Li; Moore; Doughty Nucleosides and Nucleotides, 1995 , vol. 14, # 1-2 p. 65 - 76 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(2-Deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-3H-imidazo[2 ,1-i]purine |