Deoxyadenosine monophosphate structure
|
Common Name | Deoxyadenosine monophosphate | ||
|---|---|---|---|---|
| CAS Number | 653-63-4 | Molecular Weight | 331.222 | |
| Density | 2.2±0.1 g/cm3 | Boiling Point | 753.5±70.0 °C at 760 mmHg | |
| Molecular Formula | C10H14N5O6P | Melting Point | 148 °C | |
| MSDS | Chinese USA | Flash Point | 409.5±35.7 °C | |
| Name | dAMP |
|---|---|
| Synonym | More Synonyms |
| Density | 2.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 753.5±70.0 °C at 760 mmHg |
| Melting Point | 148 °C |
| Molecular Formula | C10H14N5O6P |
| Molecular Weight | 331.222 |
| Flash Point | 409.5±35.7 °C |
| Exact Mass | 331.068176 |
| PSA | 175.65000 |
| LogP | -1.23 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.867 |
| InChIKey | KHWCHTKSEGGWEX-RRKCRQDMSA-N |
| SMILES | Nc1ncnc2c1ncn2C1CC(O)C(COP(=O)(O)O)O1 |
| Storage condition | −20°C |
| Hazard Codes | Xn,Xi |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Development of an electrochemical surface-enhanced Raman spectroscopy (EC-SERS) aptasensor for direct detection of DNA hybridization.
Phys. Chem. Chem. Phys. 17 , 21356-63, (2015) Rapid detection of disease biomarkers at the patient point-of-care is essential to timely and effective treatment. The research described herein focuses on the development of an electrochemical surfac... |
|
|
Evaluation of column hardware on liquid chromatography-mass spectrometry of phosphorylated compounds.
J. Chromatogr. A. 1381 , 125-31, (2015) The influences of column hardware, such as chromatographic tubes and frits, on liquid chromatography-mass spectrometry (LC-MS) analysis of phosphorylated compounds were evaluated. The signal to noise ... |
|
|
Organocatalytic removal of formaldehyde adducts from RNA and DNA bases.
Nature Chemistry 7 , 752-8, (2015) Formaldehyde is universally used to fix tissue specimens, where it forms hemiaminal and aminal adducts with biomolecules, hindering the ability to retrieve molecular information. Common methods for re... |
| 2'-deoxyadenosine-5'-phosphate |
| 5'-Adenylic acid, 2'-deoxy- (9CI) |
| 9-(2-Deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-9H-purin-6-amin |
| 2'-Deoxy-5'-AMP |
| 2'-Deoxy-5'-adenylate |
| 2'-Deoxyadenosine 5'-monophosphate |
| 2'-Deoxyadenylate |
| Adenosine, 2'-deoxy-, 5'-(dihydrogen phosphate) (8CI) |
| Adenosine, 2'-deoxy-, 5'-(dihydrogen phosphate) (6CI,8CI) |
| MFCD00005753 |
| EINECS 211-503-1 |
| Deoxyadenosine monophosphate |
| 2'-Deoxyadenosine-5'-monophosphoric acid |
| 2'-deoxy-5'-adenosine monophosphate |
| 2'-Deoxyadenosine 5'-phosphate |
| deoxyadenosine 5'-monophosphate |
| d-AMP |
| dAMP |
| deoxyadenosine 5'-phosphate |
| [(2R,3S,5R)-5-(6-Amino-9H-purin-9-yl)-3-hydroxytetrahydro-2-furanyl]methyl dihydrogen phosphate |
| 2'-deoxy-Adenosine 5'-phosphorate |
| Deoxy-5'-adenylate |
| 2'-deoxyadenosine monophosphate |
| 2'-Deoxyadenosine-5'-monophosphate |