Benzeneacetonitrile, a-1-cyclohexen-1-yl-a-propyl- structure
|
Common Name | Benzeneacetonitrile, a-1-cyclohexen-1-yl-a-propyl- | ||
|---|---|---|---|---|
| CAS Number | 60586-14-3 | Molecular Weight | 239.35500 | |
| Density | 1.012g/cm3 | Boiling Point | 355.2ºC at 760 mmHg | |
| Molecular Formula | C17H21N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.9ºC | |
| Name | 2-(cyclohexen-1-yl)-2-phenylpentanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.012g/cm3 |
|---|---|
| Boiling Point | 355.2ºC at 760 mmHg |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.35500 |
| Flash Point | 170.9ºC |
| Exact Mass | 239.16700 |
| PSA | 23.79000 |
| LogP | 4.74848 |
| Index of Refraction | 1.542 |
| InChIKey | IIUAGEDXDIXUEX-UHFFFAOYSA-N |
| SMILES | CCCC(C#N)(C1=CCCCC1)c1ccccc1 |
|
~%
Benzeneacetonit... CAS#:60586-14-3 |
| Literature: Whyte; Cope Journal of the American Chemical Society, 1943 , vol. 65, p. 1999,2002 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-cyclohex-1-enyl-2-phenyl-valeronitrile |