Benzeneacetyl chloride,a,a-diphenyl- structure
|
Common Name | Benzeneacetyl chloride,a,a-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 6068-70-8 | Molecular Weight | 306.78600 | |
| Density | 1.19g/cm3 | Boiling Point | 423.6ºC at 760 mmHg | |
| Molecular Formula | C20H15ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.4ºC | |
| Name | 2,2,2-triphenylacetyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 423.6ºC at 760 mmHg |
| Molecular Formula | C20H15ClO |
| Molecular Weight | 306.78600 |
| Flash Point | 208.4ºC |
| Exact Mass | 306.08100 |
| PSA | 17.07000 |
| LogP | 4.78640 |
| Index of Refraction | 1.607 |
| InChIKey | UOZBNMMELVBICG-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~99%
Benzeneacetyl c... CAS#:6068-70-8 |
| Literature: UNIVERSITY OF GREENWICH Patent: WO2009/90431 A1, 2009 ; Location in patent: Page/Page column 37 ; WO 2009/090431 A1 |
|
~%
Benzeneacetyl c... CAS#:6068-70-8 |
| Literature: Hoffmann-La Roche Inc. Patent: US4851519 A1, 1989 ; |
|
~%
Benzeneacetyl c... CAS#:6068-70-8 |
| Literature: Miriam; Wolf; Sherwin Journal of Biological Chemistry, 1926 , vol. 71, p. 695 |
|
~%
Benzeneacetyl c... CAS#:6068-70-8 |
| Literature: Schmidlin; Hodgson Chemische Berichte, 1908 , vol. 41, p. 446 |
|
~%
Benzeneacetyl c... CAS#:6068-70-8 |
| Literature: Schmidlin; Hodgson Chemische Berichte, 1908 , vol. 41, p. 446 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Triphenylacetyl chloride |
| triphenyl acetic acid chloride |
| Benzeneacetyl chloride,a,a-diphenyl |
| Triphenyl-acetylchlorid |
| triphenylethanoyl chloride |