Benzeneacetic acid, a,a-diphenyl-, methyl ester structure
|
Common Name | Benzeneacetic acid, a,a-diphenyl-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 5467-21-0 | Molecular Weight | 302.36600 | |
| Density | 1.122g/cm3 | Boiling Point | 416.8ºC at 760mmHg | |
| Molecular Formula | C21H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148ºC | |
| Name | methyl 2,2,2-triphenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 416.8ºC at 760mmHg |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.36600 |
| Flash Point | 148ºC |
| Exact Mass | 302.13100 |
| PSA | 26.30000 |
| LogP | 4.19400 |
| Index of Refraction | 1.587 |
| InChIKey | ZPGOQUZHRVSLML-UHFFFAOYSA-N |
| SMILES | COC(=O)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| triphenylacetic acid methyl ester |
| Triphenylessigsaeure-methylester |
| Methyl-triphenylacetat |
| methyl triphenylacetate |