2-Nitro-1-naphthol structure
|
Common Name | 2-Nitro-1-naphthol | ||
|---|---|---|---|---|
| CAS Number | 607-24-9 | Molecular Weight | 189.167 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 336.7±15.0 °C at 760 mmHg | |
| Molecular Formula | C10H7NO3 | Melting Point | 123-125 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 149.9±8.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Nitro-1-naphthol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 336.7±15.0 °C at 760 mmHg |
| Melting Point | 123-125 °C(lit.) |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.167 |
| Flash Point | 149.9±8.8 °C |
| Exact Mass | 189.042587 |
| PSA | 66.05000 |
| LogP | 2.94 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.714 |
| InChIKey | MUCCHGOWMZTLHK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2ccccc2c1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2929909090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
The biochemistry of aromatic amines. 8. Synthesis and detection of di-(2-amino-1-naphthyl) hydrogen phosphate, a metabolite of 2-naphthylamine in dogs.
Biochem. J. 78(1) , 175-9, (1961)
|
|
|
Synthesis, resolution and rates of racemisation of 1-(2'-methyl-3'-indenyl)-2-naphthylamine and-2-naphthol. Baker RW and Taylor JA.
Tetrahedron Lett. 41(22) , 4471-73, (2000)
|
|
|
Alkaline phosphatase as a label for immunoassay using amperometric detection with a variety of substrates and an optimal buffer system. Kreuzer MP, et al.
Anal. Chim. Acta 393(1) , 95-102, (1999)
|
| 1-Naphthalenol, 2-nitro- |
| 2-nitronaphthalen-1-ol |
| 2-Nitro-1-naphthol |
| EINECS 210-131-7 |
| MFCD00003956 |
| NAPHTHALENOL, NITRO |