4-(3-Methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid structure
|
Common Name | 4-(3-Methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 60875-16-3 | Molecular Weight | 218.209 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 477.6±28.0 °C at 760 mmHg | |
| Molecular Formula | C11H10N2O3 | Melting Point | 285 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 242.7±24.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 4-(3-Methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid4-(3-Methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid has hypoglycaemic activity. 4-(3-Methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid follows a mechanism based on the response to the oral glucose overcharge[1]. |
| Name | 4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 4-(3-Methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid has hypoglycaemic activity. 4-(3-Methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid follows a mechanism based on the response to the oral glucose overcharge[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 477.6±28.0 °C at 760 mmHg |
| Melting Point | 285 °C (dec.)(lit.) |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.209 |
| Flash Point | 242.7±24.0 °C |
| Exact Mass | 218.069138 |
| PSA | 69.97000 |
| LogP | 0.11 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | CUGBBQWDGCXWNB-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2ccc(C(=O)O)cc2)C(=O)C1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933199090 |
|
~86%
4-(3-Methyl-5-o... CAS#:60875-16-3 |
| Literature: Bianchini, Roberto; Bonanni, Marco; Corsi, Massimo; Infantino, Angela Simona Tetrahedron, 2012 , vol. 68, # 41 p. 8636 - 8644 |
|
~%
4-(3-Methyl-5-o... CAS#:60875-16-3 |
| Literature: US6034099 A1, ; |
|
~%
4-(3-Methyl-5-o... CAS#:60875-16-3 |
| Literature: US6034099 A1, ; |
|
~%
4-(3-Methyl-5-o... CAS#:60875-16-3 |
| Literature: Chemistry and Biology, , vol. 17, # 5 p. 471 - 482 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Pharmacological studies of the two new hypoglycaemic compounds 4-(3-methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid and 1-(mesitylen-2-sulfonyl)-1H-1,2,4-triazole.
Arzneimittelforschung 44(7) , 821-6, (1994) New compounds showing hypoglycaemic activity have been designed through a computer-aided method based on QSAR (quantitative structure activity relationship) and molecular connectivity. The pharmacolog... |
| EINECS 262-509-6 |
| Benzoic acid, 4-(4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl)- |
| MFCD00003135 |
| 1-(4-Carboxylphenyl)-3-methyl-5-pyrazolone |
| 4-(3-Methyl-5-oxo-4,5-dihydro-1H-pyrazol-1-yl)benzoic acid |
| 4-(3-Methyl-5-oxo-2-pyrazolin-1-yl)benzoicacid |