Ceforanide structure
|
Common Name | Ceforanide | ||
|---|---|---|---|---|
| CAS Number | 60925-61-3 | Molecular Weight | 519.55400 | |
| Density | 1.79 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H21N7O6S2 | Melting Point | >150° (dec) | |
| MSDS | N/A | Flash Point | N/A | |
| Symbol |
GHS08 |
Signal Word | Danger | |
Use of CeforanideCeforanide is a second generation cephalosporin administered intravenously or intramuscularly. Ceforanide has a spectrum of in vitro antibacterial activity[1]. |
| Name | ceforanide |
|---|---|
| Synonym | More Synonyms |
| Description | Ceforanide is a second generation cephalosporin administered intravenously or intramuscularly. Ceforanide has a spectrum of in vitro antibacterial activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.79 g/cm3 |
|---|---|
| Melting Point | >150° (dec) |
| Molecular Formula | C20H21N7O6S2 |
| Molecular Weight | 519.55400 |
| Exact Mass | 519.09900 |
| PSA | 244.23000 |
| LogP | 0.31890 |
| Index of Refraction | 1.829 |
| InChIKey | SLAYUXIURFNXPG-CRAIPNDOSA-N |
| SMILES | NCc1ccccc1CC(=O)NC1C(=O)N2C(C(=O)O)=C(CSc3nnnn3CC(=O)O)CSC12 |
| Storage condition | -20℃ |
| Symbol |
GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H317-H334 |
| Precautionary Statements | P261-P280-P284-P304 + P340-P342 + P311 |
| RIDADR | NONH for all modes of transport |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Radacef |
| Ceforanidum |
| (6R)-7t-[2-(2-aminomethyl-phenyl)-acetylamino]-3-(1-carboxymethyl-1H-tetrazol-5-ylsulfanylmethyl)-8-oxo-(6rH)-5-thia-1-aza-bicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Ceforanido |
| CEFORANIDE |
| Precef |
| (6R,7R)-7-[[2-[2-(aminomethyl)phenyl]acetyl]amino]-3-[[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Ceforanido [INN-Spanish] |
| bl s786 |
| Ceforanidum [INN-Latin] |