Dimethyl 4-nitrophthalate structure
|
Common Name | Dimethyl 4-nitrophthalate | ||
|---|---|---|---|---|
| CAS Number | 610-22-0 | Molecular Weight | 239.182 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 314.6±0.0 °C at 760 mmHg | |
| Molecular Formula | C10H9NO6 | Melting Point | 64-66 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 153.8±25.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Dimethyl 4-nitrophthalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 314.6±0.0 °C at 760 mmHg |
| Melting Point | 64-66 °C(lit.) |
| Molecular Formula | C10H9NO6 |
| Molecular Weight | 239.182 |
| Flash Point | 153.8±25.7 °C |
| Exact Mass | 239.042984 |
| PSA | 98.42000 |
| LogP | 1.13 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | XWBDWELWBUWSNI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])cc1C(=O)OC |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917399090 |
|
~42%
Dimethyl 4-nitr... CAS#:610-22-0 |
| Literature: Journal of Organic Chemistry, , vol. 66, # 12 p. 4356 - 4360 |
|
~%
Dimethyl 4-nitr... CAS#:610-22-0 |
| Literature: Monatshefte fuer Chemie, , vol. 21, p. 794 |
|
~%
Dimethyl 4-nitr... CAS#:610-22-0 |
| Literature: Monatshefte fuer Chemie, , vol. 21, p. 794 |
|
~%
Dimethyl 4-nitr... CAS#:610-22-0 |
| Literature: Trody Kazansk. chim. technol. Inst.Chem.Abstr., , # 26 p. 78,79 Trody Kazansk. chim. technol. Inst.Chem.Abstr., , p. 449 |
| Precursor 4 | |
|---|---|
| DownStream 8 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Development of highly specific fluorescence immunoassay and enzyme-linked immunosorbent assay for detection of dimethyl phthalate in water samples. Zhang M, et al.
Food Agric Immunol 22(4) , 297-309, (2011)
|
| EINECS 210-212-7 |
| Phthalic acid, 4-nitro-, dimethyl ester |
| 5-Nitroisophthyl acid dimethyl ester |
| dimethyl 4-nitrobenzene-1,2-dicarboxylate |
| Dimethyl 4-nitrophthalate |
| MFCD00017191 |
| 1,2-Benzenedicarboxylic acid, 4-nitro-, dimethyl ester |