dimethyl 4-dimethylaminophthalate
dimethyl 4-dimethylaminophthalate structure
|
Common Name | dimethyl 4-dimethylaminophthalate | ||
|---|---|---|---|---|
| CAS Number | 39617-05-5 | Molecular Weight | 237.25200 | |
| Density | 1.167g/cm3 | Boiling Point | 345.7ºC at 760 mmHg | |
| Molecular Formula | C12H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.9ºC | |
| Name | dimethyl 4-(dimethylamino)benzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 345.7ºC at 760 mmHg |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25200 |
| Flash Point | 162.9ºC |
| Exact Mass | 237.10000 |
| PSA | 55.84000 |
| LogP | 1.32580 |
| Index of Refraction | 1.543 |
| InChIKey | IQMSCTLQIWAFDD-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N(C)C)cc1C(=O)OC |
| HS Code | 2922499990 |
|---|
|
~86%
dimethyl 4-dime... CAS#:39617-05-5 |
| Literature: BASF Aktiengesellschaft Patent: US4002664 A1, 1977 ; |
|
~84%
dimethyl 4-dime... CAS#:39617-05-5 |
| Literature: BASF Aktiengesellschaft Patent: US4002664 A1, 1977 ; |
|
~%
dimethyl 4-dime... CAS#:39617-05-5 |
| Literature: Rational Drug Design Laboratories Patent: US5698580 A1, 1997 ; |
|
~44%
dimethyl 4-dime... CAS#:39617-05-5 |
| Literature: Bader, Hubert; Reissig, Hans-Ulrich Tetrahedron, 1986 , vol. 42, # 3 p. 835 - 838 |
|
~%
dimethyl 4-dime... CAS#:39617-05-5 |
| Literature: Neunhoeffer,H.; Werner,G. Justus Liebigs Annalen der Chemie, 1973 , p. 1955 - 1962 |
|
~%
dimethyl 4-dime... CAS#:39617-05-5 |
| Literature: Gompper, Rudolf; Heinemann, Ulrich Angewandte Chemie, 1980 , vol. 92, # 3 p. 207 - 208 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| dimethyl 4-(dimethylamino)phthalate |
| 4-dimethylamino-phthalic acid dimethyl ester |
| EINECS 254-544-0 |
| 4-(dimethylamino)-1,2-benzenedicarboxylic acid |
| 4-(Dimethylamino)-phthalsaeure-dimethylester |
| 4-Methylamino-phthalsaeure-dimethylester |
| dimethyl 4-N,N-dimethylaminophthalate |
| Methyl-4-dimethylaminophthalat |