5-tert-butyl-2-chloro-3-(hydroxymethylidene)cyclohexene-1-carbaldehyde structure
|
Common Name | 5-tert-butyl-2-chloro-3-(hydroxymethylidene)cyclohexene-1-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 61009-99-2 | Molecular Weight | 228.71500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-tert-butyl-2-chloro-3-(hydroxymethylidene)cyclohexene-1-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H17ClO2 |
|---|---|
| Molecular Weight | 228.71500 |
| Exact Mass | 228.09200 |
| PSA | 37.30000 |
| LogP | 3.57620 |
| InChIKey | WZGNXTLANSENNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CC(=CO)C(Cl)=C(C=O)C1 |
| HS Code | 2913000090 |
|---|
|
~89%
5-tert-butyl-2-... CAS#:61009-99-2 |
| Literature: ECOLE NORMALE SUPERIEURE DE LYON; Bretonniere, Yann; Andraud, Chantal; Buron, Wissam Patent: US2013/123508 A1, 2013 ; Location in patent: Paragraph 0164-0166 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 5-tert-Butyl-2-chlor-1-formyl-3-hydroxymethylencyclohexen |
| 5-tert-butyl-2-chloro-3-hydroxymethylene-cyclohex-1-ene carbaldehyde |
| 5-TERT-BUTYL-2-CHLORO-3-HYDROXYMETHYLENE-CYCLOHEX-1-ENE CARBOXALDEHYDE |