trimethyl-[(2,4,6-trimethoxyphenyl)methoxy]silane structure
|
Common Name | trimethyl-[(2,4,6-trimethoxyphenyl)methoxy]silane | ||
|---|---|---|---|---|
| CAS Number | 61040-74-2 | Molecular Weight | 270.39700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22O4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[(2,4,6-trimethoxyphenyl)methoxy]silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H22O4Si |
|---|---|
| Molecular Weight | 270.39700 |
| Exact Mass | 270.12900 |
| PSA | 36.92000 |
| LogP | 3.06390 |
| InChIKey | GKFNHVHCBNEJOK-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(CO[Si](C)(C)C)c(OC)c1 |
|
~%
trimethyl-[(2,4... CAS#:61040-74-2 |
| Literature: Midgley,J.M. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1384 - 1385 |
| Silane,trimethyl[(2,4,6-trimethoxyphenyl)methoxy] |