trimethyl-(2,4,6-trinitrophenoxy)silane structure
|
Common Name | trimethyl-(2,4,6-trinitrophenoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 62967-61-7 | Molecular Weight | 301.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11N3O7Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(2,4,6-trinitrophenoxy)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11N3O7Si |
|---|---|
| Molecular Weight | 301.28500 |
| Exact Mass | 301.03700 |
| PSA | 146.69000 |
| LogP | 4.19450 |
| InChIKey | QZCBQLREKZEOJG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)Oc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
trimethyl-(2,4,... CAS#:62967-61-7 |
| Literature: Ellington, Joe Carey; Arnett, E. M. Journal of the American Chemical Society, 1988 , vol. 110, # 23 p. 7778 - 7785 |
| Silane,trimethyl(2,4,6-trinitrophenoxy) |