2-Nitro-p-acetotoluidide structure
|
Common Name | 2-Nitro-p-acetotoluidide | ||
|---|---|---|---|---|
| CAS Number | 612-45-3 | Molecular Weight | 194.18700 | |
| Density | 1.289g/cm3 | Boiling Point | 392.581ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.226ºC | |
| Name | p-Acetotoluidide, 2'-nitro |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 392.581ºC at 760 mmHg |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.18700 |
| Flash Point | 191.226ºC |
| Exact Mass | 194.06900 |
| PSA | 74.92000 |
| LogP | 2.45780 |
| Index of Refraction | 1.605 |
| InChIKey | LQZGUJSFLJIJKA-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C)cc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-methyl-2-bromophenyl)-2-nitrobenzenesulfonamide |
| N-(4-methyl-2-nitrophenyl)acetamide |
| 2-nitro-4-metylacetanilide |
| N-(2-bromo-4-methylphenyl)-2-nitro-benzenesulfonamide |
| 4-methyl-2-nitroacetanilide |
| 3-nitro-4-acetamidotoluene |
| 4-methyl-2-nitroacetamidotoluene |
| acetic acid-(4-methyl-2-nitro-anilide) |
| (2-bromo-4-methylphenyl)[(2-nitrophenyl)sulfonyl]amine |