4-(SEC-BUTOXY)ANILINE
Modify Date: 2025-08-25 22:55:17
4-(SEC-BUTOXY)ANILINE structure
|
Common Name | 4-(SEC-BUTOXY)ANILINE | ||
|---|---|---|---|---|
| CAS Number | 61251-99-8 | Molecular Weight | 240.30000 | |
| Density | 1.148g/cm3 | Boiling Point | 482.2ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | USA | Flash Point | 245.4ºC | |
| Name | 4-amino-N-(2-phenylethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 482.2ºC at 760 mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30000 |
| Flash Point | 245.4ºC |
| Exact Mass | 240.12600 |
| PSA | 55.12000 |
| LogP | 3.21340 |
| Index of Refraction | 1.617 |
| InChIKey | MIHLCBDTDZSJDS-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)NCCc2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
![4-[(tert-butoxycarbonyl)amino]-N-(β-phenethyl)benzamide structure](https://image.chemsrc.com/caspic/125/327037-49-0.png)
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-amino-benzoic acid phenethylamide |
| 4-Amino-benzoesaeure-phenaethylamid |
| 4-Amino-N-phenaethyl-benzamid |
| 4-amino-N-phenethylbenzamide |