diethyl 5-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate structure
|
Common Name | diethyl 5-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 6147-96-2 | Molecular Weight | 439.91000 | |
| Density | 1.318g/cm3 | Boiling Point | 600.8ºC at 760 mmHg | |
| Molecular Formula | C20H22ClNO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.2ºC | |
| Name | diethyl 5-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 600.8ºC at 760 mmHg |
| Molecular Formula | C20H22ClNO6S |
| Molecular Weight | 439.91000 |
| Flash Point | 317.2ºC |
| Exact Mass | 439.08600 |
| PSA | 122.66000 |
| LogP | 5.03870 |
| Index of Refraction | 1.589 |
| InChIKey | SIJYVNOMRYJECI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1sc(NC(=O)COc2ccc(Cl)cc2C)c(C(=O)OCC)c1C |
|
~14%
diethyl 5-[[2-(... CAS#:6147-96-2 |
| Literature: Costi, M. Paola; Gelain, Arianna; Barlocco, Daniela; Ghelli, Stefano; Soragni, Fabrizia; Reniero, Fabiano; Rossi, Tiziana; Ruberto, Antonio; Guillou, Claude; Cavazzuti, Antonio; Casolari, Chiara; Ferrari, Stefania Journal of Medicinal Chemistry, 2006 , vol. 49, # 20 p. 5958 - 5968 |
|
~14%
diethyl 5-[[2-(... CAS#:6147-96-2 |
| Literature: TYDOCKPHARMA S.R.L. Patent: WO2008/3510 A1, 2008 ; Location in patent: Page/Page column 10-11 ; WO 2008/003510 A1 |