(2-nitrophenyl) 2-phenylmethoxycarbonylaminoacetate structure
|
Common Name | (2-nitrophenyl) 2-phenylmethoxycarbonylaminoacetate | ||
|---|---|---|---|---|
| CAS Number | 6154-41-2 | Molecular Weight | 330.29200 | |
| Density | 1.348g/cm3 | Boiling Point | 536.2ºC at 760 mmHg | |
| Molecular Formula | C16H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.1ºC | |
| Name | (2-nitrophenyl) 2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 536.2ºC at 760 mmHg |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.29200 |
| Flash Point | 278.1ºC |
| Exact Mass | 330.08500 |
| PSA | 110.45000 |
| LogP | 3.34070 |
| Index of Refraction | 1.595 |
| InChIKey | QLQCLAKOYRMJTG-UHFFFAOYSA-N |
| SMILES | O=C(CNC(=O)OCc1ccccc1)Oc1ccccc1[N+](=O)[O-] |
|
~%
(2-nitrophenyl)... CAS#:6154-41-2 |
| Literature: Bodanszky,M. et al. Journal of Organic Chemistry, 1974 , vol. 39, # 4 p. 444 - 447 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Z-Gly-O-o-nitrophenylester |
| Carbobenzoxyglycin-o-nitrophenylester |