(S,S,S)-DiazaPhos-PPE structure
|
Common Name | (S,S,S)-DiazaPhos-PPE | ||
|---|---|---|---|---|
| CAS Number | 615538-63-1 | Molecular Weight | 742.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C46H39N4O4P | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | (S,S,S)-DiazaPhos-PPE |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C46H39N4O4P |
|---|---|
| Molecular Weight | 742.8 |
| Exact Mass | 742.270874 |
| LogP | 6.80 |
| InChIKey | XLHCPIVFAWUOET-OQGDIVOVSA-N |
| SMILES | CC(NC(=O)c1ccccc1C1n2c(=O)c3ccccc3c(=O)n2C(c2ccccc2C(=O)NC(C)c2ccccc2)P1c1ccccc1)c1ccccc1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
|
Highly active, regioselective, and enantioselective hydroformylation with Rh catalysts ligated by Bis-3,4-diazaphospholanes.
J. Am. Chem. Soc. 127 , 5040, (2005) Azines made by the reaction of hydrazine with ortho-formylbenzoic acid react with 1,2-diphosphinobenzene and either succinyl chloride or phthaloyl chloride in ca. 30% yield to give rac-bis-3,4-diazaph... |
|
|
Highly regio- and enantioselective asymmetric hydroformylation of olefins mediated by 2,5-disubstituted phospholane ligands.
Angew. Chem. Int. Ed. Engl. 44 , 5834, (2005)
|
| Benzamide, 2,2'-[(1S,3S)-2,3,5,10-tetrahydro-5,10-dioxo-2-phenyl-1H-[1,2,4]diazaphospholo[1,2-b]phthalazine-1,3-diyl]bis[N-[(1S)-1-phenylethyl]- |
| 2,2'-[(1S,3S)-2,3,5,10-Tetrahydro-5,10-dioxo-2-phenyl-1H-[1,2,4]diazaphospholo[1,2-b]phthalazine-1,3-diyl]bis[N-(1S)-1-phenylethyl]benzamide |
| (S,S,S)-Diazaphos-ppe |
| 2,2'-[(1S,3S)-5,10-Dioxo-2-phenyl-2,3,5,10-tetrahydro-1H-[1,2,4]diazaphospholo[1,2-b]phthalazine-1,3-diyl]bis{N-[(1S)-1-phenylethyl]benzamide} |