1-dimethoxyphosphoryl-2,2,2-triphenylethanone structure
|
Common Name | 1-dimethoxyphosphoryl-2,2,2-triphenylethanone | ||
|---|---|---|---|---|
| CAS Number | 61565-69-3 | Molecular Weight | 380.37400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-dimethoxyphosphoryl-2,2,2-triphenylethanone |
|---|
| Molecular Formula | C22H21O4P |
|---|---|
| Molecular Weight | 380.37400 |
| Exact Mass | 380.11800 |
| PSA | 62.41000 |
| LogP | 5.03350 |
| InChIKey | IRUOXWYUJAVDHX-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)C(=O)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~%
1-dimethoxyphos... CAS#:61565-69-3 |
| Literature: BOARD OF TRUSTEES OF THE UNIVERSITY OF ILLINOIS Patent: WO2007/137200 A2, 2007 ; Location in patent: Page/Page column title page; 3/4 ; |