trimecaine structure
|
Common Name | trimecaine | ||
|---|---|---|---|---|
| CAS Number | 616-68-2 | Molecular Weight | 248.364 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 360.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C15H24N2O | Melting Point | 44° | |
| MSDS | N/A | Flash Point | 171.7±24.6 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 360.3±30.0 °C at 760 mmHg |
| Melting Point | 44° |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.364 |
| Flash Point | 171.7±24.6 °C |
| Exact Mass | 248.188858 |
| PSA | 32.34000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | GOZBHBFUQHMKQB-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)Nc1c(C)cc(C)cc1C |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
trimecaine CAS#:616-68-2 |
| Literature: Arkiv foer Kemi, , vol. 22A, # 18 p. 11 |
|
~%
trimecaine CAS#:616-68-2 |
| Literature: Arkiv foer Kemi, , vol. 22A, # 18 p. 11 |
|
~%
trimecaine CAS#:616-68-2 |
| Literature: Arkiv foer Kemi, , vol. 22A, # 18 p. 11 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 10 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: S16 Schwann cell viability assay (CellTiter-Glo assay)
Source: NCGC
Target: N/A
External Id: cmt-p4-fda-celltiter_regid
|
|
Name: Biochemical firefly luciferase enzyme assay for NPC
Source: NCGC
Target: Luciferase [Photinus pyralis]
External Id: adst-fluc-km-fda-o1_regid
|
|
Name: S16 Schwann cell PMP22 intronic element firefly luciferase assay
Source: NCGC
Target: peripheral myelin protein 22 [Rattus norvegicus]
External Id: cmt-p4-fluc-fda_regid
|
|
Name: qHTS for Inhibitors of Polymerase Kappa
Source: NCGC
Target: DNA polymerase kappa [Homo sapiens]
External Id: PolK100
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Justecaina |
| Trimecain |
| Mesidicain |
| trimecaine |
| Mesokain |
| N,N-Diethyl-N-mesitylglycinamide |
| 2-Diethylaminoacetyl-2',4',6'-trimethylanilide |
| Mesidicaine |
| N-sym-Trimethylphenyldiethylaminoacetamide |
| Diethylglycinemesidide |
| Mesocaine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide have? |
| A: English synonyms of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide: Justecaina, Trimecain, Mesidicain, trimecaine, Mesokain, N,N-Diethyl-N-mesitylglycinamide, 2-Diethylaminoacetyl-2',4',6'-trimethylanilide, Mesidicaine, N-sym-Trimethylphenyldiethylaminoacetamide, Diethylglycinemesidide, Mesocaine. |
| Q: What are the downstream products of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide? |
| A: Related downstream products(CAS) of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide: 68638-18-6;68638-19-7;68638-21-1;79143-64-9;79143-65-0;79143-66-1;79143-73-0;79143-74-1;79143-75-2;79154-29-3. |
| Q: What is the LogP of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide? |
| A: LogP of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide is 2.82. |
| Q: What is the polar surface area (PSA) of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide? |
| A: Polar surface area (PSA) of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide is 32.34000. |
| Q: What is the melting point of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide? |
| A: Melting point of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide is 44°. |
| Q: What is the SMILES notation of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide? |
| A: SMILES notation of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide is CCN(CC)CC(=O)Nc1c(C)cc(C)cc1C. |
| Q: What is the molecular weight of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide? |
| A: Molecular weight of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide is 248.364. |
| Q: What is the boiling point of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide? |
| A: Boiling point of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide is 360.3±30.0 °C at 760 mmHg. |
| Q: What is the English name of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide? |
| A: The English name of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide is 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide. |
| Q: What is the CAS number of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide? |
| A: CAS number of 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide is 616-68-2. |