1,1-bis(2,2,2-trifluoroethoxy)cyclobutane structure
|
Common Name | 1,1-bis(2,2,2-trifluoroethoxy)cyclobutane | ||
|---|---|---|---|---|
| CAS Number | 61613-10-3 | Molecular Weight | 252.15400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1-bis(2,2,2-trifluoroethoxy)cyclobutane |
|---|
| Molecular Formula | C8H10F6O2 |
|---|---|
| Molecular Weight | 252.15400 |
| Exact Mass | 252.05800 |
| PSA | 18.46000 |
| LogP | 3.02440 |
| InChIKey | GKPFDVYUUOWJBP-UHFFFAOYSA-N |
| SMILES | FC(F)(F)COC1(OCC(F)(F)F)CCC1 |
|
~9%
1,1-bis(2,2,2-t... CAS#:61613-10-3 |
| Literature: Hanack,M.; Auchter,G. Journal of the American Chemical Society, 1985 , vol. 107, p. 5238 |
|
~%
1,1-bis(2,2,2-t... CAS#:61613-10-3 |
| Literature: Hanack,M. et al. Journal of the American Chemical Society, 1979 , vol. 101, p. 100 - 108 |