1,1,1-trichlorobut-3-en-2-ylbenzene structure
|
Common Name | 1,1,1-trichlorobut-3-en-2-ylbenzene | ||
|---|---|---|---|---|
| CAS Number | 61670-63-1 | Molecular Weight | 235.53700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9Cl3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1-trichlorobut-3-en-2-ylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9Cl3 |
|---|---|
| Molecular Weight | 235.53700 |
| Exact Mass | 233.97700 |
| LogP | 4.32640 |
| InChIKey | XBZHYVFPDGYMCL-UHFFFAOYSA-N |
| SMILES | C=CC(c1ccccc1)C(Cl)(Cl)Cl |
|
~%
1,1,1-trichloro... CAS#:61670-63-1 |
| Literature: Bury,A. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1979 , p. 1050 - 1057 |
| 4,4,4-Trichlor-3-phenyl-but-1-en |