5-benzyl-6-methyl-1,3-oxazine-2,4-dione structure
|
Common Name | 5-benzyl-6-methyl-1,3-oxazine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 61736-41-2 | Molecular Weight | 217.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-benzyl-6-methyl-1,3-oxazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11NO3 |
|---|---|
| Molecular Weight | 217.22100 |
| Exact Mass | 217.07400 |
| PSA | 63.33000 |
| LogP | 1.63960 |
| InChIKey | WNAVPLMCNSJQCK-UHFFFAOYSA-N |
| SMILES | Cc1oc(=O)[nH]c(=O)c1Cc1ccccc1 |
|
~%
5-benzyl-6-meth... CAS#:61736-41-2 |
| Literature: Ahmed,S. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 1969 - 1975 |
| 2H-1,3-Oxazine-2,4(3H)-dione,6-methyl-5-(phenylmethyl) |
| 5-benzyl-6-methyl-[1,3]oxazine-2,4-dione |
| 5-Benzyl-6-methyl-1,3-oxazin-2,4(3H)-dion |