Ethyl 3,4,5-trimethoxybenzoate structure
|
Common Name | Ethyl 3,4,5-trimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 6178-44-5 | Molecular Weight | 240.252 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 292.0±7.0 °C at 760 mmHg | |
| Molecular Formula | C12H16O5 | Melting Point | 54 °C | |
| MSDS | N/A | Flash Point | 123.4±18.2 °C | |
Use of Ethyl 3,4,5-trimethoxybenzoateEthyl 3,4,5-trimethoxybenzoate is a natural compound isolated from the roots of Rauvolfia yunnanensis Tsiang[1]. |
| Name | Ethyl 3,4,5-trimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Description | Ethyl 3,4,5-trimethoxybenzoate is a natural compound isolated from the roots of Rauvolfia yunnanensis Tsiang[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 292.0±7.0 °C at 760 mmHg |
| Melting Point | 54 °C |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.252 |
| Flash Point | 123.4±18.2 °C |
| Exact Mass | 240.099777 |
| PSA | 53.99000 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | UEOFNBCUGJADBM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(OC)c(OC)c(OC)c1 |
| Hazard Codes | Xn,Xi |
|---|---|
| Risk Phrases | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,4,5-Trimethoxy-benzoesaeure-aethylester |
| Benzoic acid, 3,4,5-trimethoxy-, ethyl ester |
| 3,4,5-trimethoxy-benzoic acid ethyl ester |
| 3,4,5-Trimethoxy-benzoesaeure-ethylester |
| Ethyl 3,4,5-trimethoxybenzoate |
| ethyl m,p,m'-trimethoxybenzoate |
| MFCD00017525 |
| Ethyl 3,4,5-trimethoxy benzoate |
| Trimethylaethergallussaeure-aethylester |
| ethyltrimethoxy benzoate |