Benzoic acid,3,5-dinitro-, ethyl ester structure
|
Common Name | Benzoic acid,3,5-dinitro-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 618-71-3 | Molecular Weight | 240.17000 | |
| Density | 1.433g/cm3 | Boiling Point | 367.1ºC at 760 mmHg | |
| Molecular Formula | C9H8N2O6 | Melting Point | 94-95 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 171.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ethyl 3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 367.1ºC at 760 mmHg |
| Melting Point | 94-95 °C(lit.) |
| Molecular Formula | C9H8N2O6 |
| Molecular Weight | 240.17000 |
| Flash Point | 171.8ºC |
| Exact Mass | 240.03800 |
| PSA | 117.94000 |
| LogP | 2.72610 |
| Index of Refraction | 1.58 |
| InChIKey | IBQREHJPMPCXQA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | Xn |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
The mechanism of action of ethanolamine deaminase. I. Studies with isotopic hydrogen and oxygen.
J. Biol. Chem. 244(2) , 449-56, (1969)
|
|
|
Aggregates of hexakis (n-hexyloxy) triphenylene self-assemble in dodecane solution: intercalation of (-)-menthol 3, 5-dinitrobenzoate induces formation of helical structures. Gallivan JP and Schuster GB.
J. Org. Chem. 60(8) , 2423-29, (1995)
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 3,5-dinitro-benzoic acid ethyl ester |
| Benzoic acid,3,5-dinitro-,ethyl ester |
| EINECS 210-559-4 |
| 3,5-Dinitro-benzoesaeure-aethylester |
| MFCD00007232 |
| Aethyl-(3.5-dinitro-benzoat) |