Benzoic acid, 3-nitro-,ethyl ester structure
|
Common Name | Benzoic acid, 3-nitro-,ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 618-98-4 | Molecular Weight | 195.17200 | |
| Density | 1.253g/cm3 | Boiling Point | 297-298°C | |
| Molecular Formula | C9H9NO4 | Melting Point | 41 °C | |
| MSDS | N/A | Flash Point | 297-298°C | |
| Name | ethyl 3-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 297-298°C |
| Melting Point | 41 °C |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17200 |
| Flash Point | 297-298°C |
| Exact Mass | 195.05300 |
| PSA | 72.12000 |
| LogP | 2.29470 |
| Index of Refraction | 1.544 |
| InChIKey | MKBIJCPQTPFQKQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccc([N+](=O)[O-])c1 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2916399090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| ethyl-3-nitrobenzoate |
| m-nitro-carboethoxy-benzene |
| Ethyl-m-nitrobenzoate |
| EINECS 210-574-6 |
| MFCD00014702 |
| 3-Nitro-benzoesaeure-aethylester |
| Benzoic acid,3-nitro-,ethyl ester |
| m-Nitrobenzoic acid,ethyl ester |
| 3-nitro-benzoic acid ethyl ester |