6-(4-methoxyphenyl)-1,3,5-triazinane-2,4-dithione structure
|
Common Name | 6-(4-methoxyphenyl)-1,3,5-triazinane-2,4-dithione | ||
|---|---|---|---|---|
| CAS Number | 61851-94-3 | Molecular Weight | 253.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11N3OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-methoxyphenyl)-1,3,5-triazinane-2,4-dithione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11N3OS2 |
|---|---|
| Molecular Weight | 253.34400 |
| Exact Mass | 253.03400 |
| PSA | 123.58000 |
| LogP | 1.06860 |
| InChIKey | OALGLVCMBQVCTB-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2NC(=S)NC(=S)N2)cc1 |
|
~46%
6-(4-methoxyphe... CAS#:61851-94-3 |
| Literature: Butler, Anthony R.; Hussain, Ishtiaq Journal of Chemical Research, Miniprint, 1994 , # 1 p. 261 - 273 |
|
~%
6-(4-methoxyphe... CAS#:61851-94-3 |
| Literature: Foye; Hefferren Journal of the American Pharmaceutical Association (1912-1977), 1953 , vol. 42, p. 31 |
| 1,3,5-Triazine-2,4(1H,3H)-dithione,dihydro-6-(4-methoxyphenyl) |
| 6-(4-methoxy-phenyl)-dihydro-[1,3,5]triazine-2,4-dithione |
| 6-(4-methoxyphenyl)-2,4-dithioxo-1,3,5-triazinane |
| 6-(4-Methoxy-phenyl)-dihydro-[1,3,5]triazin-2,4-dithion |
| 6-(4-methoxy-phenyl)-[1,3,5]triazinane-2,4-dithione |