3-(4-hydroxyphenyl)-3-phenyl-propanoic acid structure
|
Common Name | 3-(4-hydroxyphenyl)-3-phenyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 61904-45-8 | Molecular Weight | 242.27000 | |
| Density | 1.238g/cm3 | Boiling Point | 414.5ºC at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.6ºC | |
| Name | 3-(4-hydroxyphenyl)-3-phenylpropanoic acid |
|---|
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 414.5ºC at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 218.6ºC |
| Exact Mass | 242.09400 |
| PSA | 57.53000 |
| LogP | 2.99880 |
| Index of Refraction | 1.615 |
| InChIKey | NYNULBKKGCBKDS-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(c1ccccc1)c1ccc(O)cc1 |
|
~%
3-(4-hydroxyphe... CAS#:61904-45-8 |
| Literature: Bogert; Marcus Journal of the American Chemical Society, 1919 , vol. 41, p. 97 |
|
~%
3-(4-hydroxyphe... CAS#:61904-45-8 |
| Literature: Rhein. Kampfer-Fabr. Patent: DE621454 , 1931 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 22, p. 317 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |