2-(3-FORMYL-2-METHYL-INDOL-1-YL)-ACETAMIDE structure
|
Common Name | 2-(3-FORMYL-2-METHYL-INDOL-1-YL)-ACETAMIDE | ||
|---|---|---|---|---|
| CAS Number | 61922-00-7 | Molecular Weight | 216.23600 | |
| Density | 1.27g/cm3 | Boiling Point | 488.1ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 249ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 2-(3-Formyl-2-methyl-1H-indol-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 488.1ºC at 760 mmHg |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.23600 |
| Flash Point | 249ºC |
| Exact Mass | 216.09000 |
| PSA | 65.09000 |
| LogP | 1.94780 |
| Index of Refraction | 1.625 |
| InChIKey | YPMNUMFCLRBFHC-UHFFFAOYSA-N |
| SMILES | Cc1c(C=O)c2ccccc2n1CC(N)=O |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H319 |
| Precautionary Statements | P301 + P310-P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933990090 |
|
~%
2-(3-FORMYL-2-M... CAS#:61922-00-7 |
| Literature: Sterling Drug Inc. Patent: US4021448 A1, 1977 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3-formyl-2-methylindol-1-yl)acetamide |