Methacholine (chloride) structure
|
Common Name | Methacholine (chloride) | ||
|---|---|---|---|---|
| CAS Number | 62-51-1 | Molecular Weight | 195.687 | |
| Density | 1.1028 (rough estimate) | Boiling Point | N/A | |
| Molecular Formula | C8H18ClNO2 | Melting Point | 171-173ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Methacholine (chloride)Methacholine chloride is a synthetic choline ester that acts as a non-selective muscarinic receptor agonist in the parasympathetic nervous system. |
| Name | Acetyl-beta-methylcholine chloride |
|---|---|
| Synonym | More Synonyms |
| Description | Methacholine chloride is a synthetic choline ester that acts as a non-selective muscarinic receptor agonist in the parasympathetic nervous system. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1028 (rough estimate) |
|---|---|
| Melting Point | 171-173ºC(lit.) |
| Molecular Formula | C8H18ClNO2 |
| Molecular Weight | 195.687 |
| Exact Mass | 195.102600 |
| PSA | 26.30000 |
| Index of Refraction | 1.5790 (estimate) |
| InChIKey | JHPHVAVFUYTVCL-UHFFFAOYSA-M |
| SMILES | CC(=O)OC(C)C[N+](C)(C)C.[Cl-] |
| Stability | Unstable - moisture sensitive. Incompatible with oxidizing agents. |
| Water Solubility | H2O: 50 mg/mL, clear, colorless | almost transparency |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P301 + P312 + P330-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S26;S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | BR5250000 |
| HS Code | 29239000 |
|
~%
Methacholine (c... CAS#:62-51-1 |
| Literature: Journal of the American Chemical Society, , vol. 54, p. 242 US2040146 , ; US2040145 , ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Chemical genetics reveals a complex functional ground state of neural stem cells.
Nat. Chem. Biol. 3(5) , 268-273, (2007) The identification of self-renewing and multipotent neural stem cells (NSCs) in the mammalian brain holds promise for the treatment of neurological diseases and has yielded new insight into brain canc... |
|
|
Hyaluronan mediates airway hyperresponsiveness in oxidative lung injury.
Am. J. Physiol. Lung Cell. Mol. Physiol. 308 , L891-903, (2015) Chlorine (Cl2) inhalation induces severe oxidative lung injury and airway hyperresponsiveness (AHR) that lead to asthmalike symptoms. When inhaled, Cl2 reacts with epithelial lining fluid, forming by-... |
|
|
MAG-EPA and 17,18-EpETE target cytoplasmic signalling pathways to reduce short-term airway hyperresponsiveness.
Pflugers Arch. 467 , 1591-605, (2015) This study was aimed to investigate the role of eicosapentaenoic acid monoacylglyceride (MAG-EPA) and 17,18-epoxyeicosatetraenoic acid (17,18-EpETE) on the regulation of contractile reactivity and nuc... |
| Methacholinium chloride |
| Besacholine |
| Mechothane |
| 1-propanaminium, 2-[(aminocarbonyl)oxy]-N,N,N-trimethyl-, chloride |
| Methacholine chloride |
| β-Methylcholine chloride urethan |
| Urecholine chloride |
| Uro-Carb |
| 2-carbamoyloxypropyl(trimethyl)azanium,chloride |
| b-Methylacetylcholine Chloride |
| Acetyl-b-methylcholine Chloride |
| 2-Acetoxy-N,N,N-trimethylpropan-1-aminium chloride |
| (2-Carbamoyloxy-propyl)-trimethyl-ammonium,Chlorid |
| 2-(Carbamoyloxy)-N,N,N-trimethylpropan-1-aminium chloride |
| Carbamate of (2-Hydroxypropyl)trimethylammonium Chloride |
| Mictone |
| 2-(acetyloxy)-N,N,N-trimethylpropan-1-aminium chloride |
| 2-(Carbamoyloxy)-N,N,N-trimethyl-1-propanaminium chloride |
| 2-[(aminocarbonyl)oxy]-N,N,N-trimethylpropan-1-aminium chloride |
| Carbamylmethylcholine chloride |
| Urecholine |
| 2-[(Aminocarbonyl)oxy]-N,N,N-trimethyl-1-propanaminium Chloride |
| (2-Carbamoyloxypropyl)trimethylammonium chloride |
| 2-acetyloxypropyl(trimethyl)azanium,chloride |
| Bethanechol chloride |
| (2-carbamoyloxy-propyl)-trimethyl-ammonium,chloride |
| Trimethyl-b-acetoxypropylammonium Chloride |
| EINECS 200-537-2 |
| Mechotane |
| O-Acetyl-b-methylcholine Chloride |
| BTC |
| Mecothane |
| 2-carbamyloxy-1-(N,N,N-trimethyl)-propylammonium chloride |
| 1-Propanaminium, 2-[(aminocarbonyl)oxy]-N,N,N-trimethyl-, chloride (1:1) |
| methylcarbachol chloride |
| UNII:0W5ETF9M2K |
| Bethanechol |
| 1-Propanaminium, 2-(acetyloxy)-N,N,N-trimethyl-, chloride (1:1) |
| DUVOID |
| Myocholine |
| 2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride |
| MFCD00011817 |
| (±)-Acetyl-b-methylcholine Chloride |
| Methacholine (chloride) |