Benzene,1-nitro-3-phenoxy
Benzene,1-nitro-3-phenoxy structure
|
Common Name | Benzene,1-nitro-3-phenoxy | ||
|---|---|---|---|---|
| CAS Number | 620-55-3 | Molecular Weight | 215.20500 | |
| Density | 1.252g/cm3 | Boiling Point | 322.8ºC at 760 mmHg | |
| Molecular Formula | C12H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-nitro-3-phenoxybenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 322.8ºC at 760 mmHg |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.20500 |
| Flash Point | 142.8ºC |
| Exact Mass | 215.05800 |
| PSA | 55.05000 |
| LogP | 3.91030 |
| Index of Refraction | 1.605 |
| InChIKey | MEYCCIQOLYYNLD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(Oc2ccccc2)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2909309090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 7 | |
CAS#:645-00-1
CAS#:108-95-2
CAS#:585-79-5![tris[2-(2-ethoxyethoxy)ethyl]amine Structure](https://image.chemsrc.com/caspic/105/75888-21-0.png)
CAS#:75888-21-0
CAS#:121-73-3
CAS#:554-84-7
CAS#:66003-76-7
CAS#:591-50-4
CAS#:108-86-1
CAS#:139-02-6
CAS#:5410-97-9
CAS#:87812-99-5
CAS#:713-68-8
CAS#:3586-12-7
CAS#:76839-22-0
CAS#:89303-38-8
CAS#:89303-48-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(phenoxy)nitrobenzene |
| m-Nitrophenyl phenyl ether |
| m-Nitrodiphenyl ether |
| Benzene,1-nitro-3-phenoxy |
| 3-Nitrodiphenyl ether |
| Ether,m-nitrophenyl phenyl |
| (3-Nitro-phenyl)-phenyl-aether |
| meta-phenoxynitrobenzene |
| 3-Nitro-diphenylaether |
| 3-nitrophenyl phenyl ether |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 1-nitro-3-phenoxybenzene? |
| A: Related downstream products(CAS) of 1-nitro-3-phenoxybenzene: 5410-97-9;87812-99-5;713-68-8;3586-12-7;76839-22-0;89303-38-8;89303-48-0. |
| Q: What is the LogP of 1-nitro-3-phenoxybenzene? |
| A: LogP of 1-nitro-3-phenoxybenzene is 3.91030. |
| Q: What is the InChIKey of 1-nitro-3-phenoxybenzene? |
| A: InChIKey of 1-nitro-3-phenoxybenzene is MEYCCIQOLYYNLD-UHFFFAOYSA-N. |
| Q: What English synonyms does 1-nitro-3-phenoxybenzene have? |
| A: English synonyms of 1-nitro-3-phenoxybenzene: 3-(phenoxy)nitrobenzene, m-Nitrophenyl phenyl ether, m-Nitrodiphenyl ether, Benzene,1-nitro-3-phenoxy, 3-Nitrodiphenyl ether, Ether,m-nitrophenyl phenyl, (3-Nitro-phenyl)-phenyl-aether, meta-phenoxynitrobenzene, 3-Nitro-diphenylaether, 3-nitrophenyl phenyl ether. |
| Q: What is the boiling point of 1-nitro-3-phenoxybenzene? |
| A: Boiling point of 1-nitro-3-phenoxybenzene is 322.8ºC at 760 mmHg. |
| Q: What is the CAS number of 1-nitro-3-phenoxybenzene? |
| A: CAS number of 1-nitro-3-phenoxybenzene is 620-55-3. |
| Q: What is the molecular weight of 1-nitro-3-phenoxybenzene? |
| A: Molecular weight of 1-nitro-3-phenoxybenzene is 215.20500. |
| Q: What is the English name of 1-nitro-3-phenoxybenzene? |
| A: The English name of 1-nitro-3-phenoxybenzene is 1-nitro-3-phenoxybenzene. |
| Q: What is the molecular formula of 1-nitro-3-phenoxybenzene? |
| A: Molecular formula of 1-nitro-3-phenoxybenzene is C12H9NO3. |
| Q: What is the SMILES notation of 1-nitro-3-phenoxybenzene? |
| A: SMILES notation of 1-nitro-3-phenoxybenzene is O=[N+]([O-])c1cccc(Oc2ccccc2)c1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |