Benzene,1-nitro-3-phenoxy structure
|
Common Name | Benzene,1-nitro-3-phenoxy | ||
|---|---|---|---|---|
| CAS Number | 620-55-3 | Molecular Weight | 215.20500 | |
| Density | 1.252g/cm3 | Boiling Point | 322.8ºC at 760 mmHg | |
| Molecular Formula | C12H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.8ºC | |
| Name | 1-nitro-3-phenoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 322.8ºC at 760 mmHg |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.20500 |
| Flash Point | 142.8ºC |
| Exact Mass | 215.05800 |
| PSA | 55.05000 |
| LogP | 3.91030 |
| Index of Refraction | 1.605 |
| InChIKey | MEYCCIQOLYYNLD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(Oc2ccccc2)c1 |
| HS Code | 2909309090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-(phenoxy)nitrobenzene |
| m-Nitrophenyl phenyl ether |
| m-Nitrodiphenyl ether |
| Benzene,1-nitro-3-phenoxy |
| 3-Nitrodiphenyl ether |
| Ether,m-nitrophenyl phenyl |
| (3-Nitro-phenyl)-phenyl-aether |
| meta-phenoxynitrobenzene |
| 3-Nitro-diphenylaether |
| 3-nitrophenyl phenyl ether |