Benzenamine,4-methyl-N-(4-nitrophenyl) structure
|
Common Name | Benzenamine,4-methyl-N-(4-nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 620-89-3 | Molecular Weight | 228.24700 | |
| Density | 1.243g/cm3 | Boiling Point | 398.9ºC at 760mmHg | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195ºC | |
| Name | 4-methyl-N-(4-nitrophenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 398.9ºC at 760mmHg |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.24700 |
| Flash Point | 195ºC |
| Exact Mass | 228.09000 |
| PSA | 57.85000 |
| LogP | 4.24300 |
| Index of Refraction | 1.65 |
| InChIKey | AMAHTMJTDVOIFX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2ccc([N+](=O)[O-])cc2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| N-p-nitrophenyl-p-toluidine |
| 4'-Nitro-4-methyl-diphenylamin |
| 4-methyl-4'-nitrodiphenylamine |