4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide
4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide structure
|
Common Name | 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide | ||
|---|---|---|---|---|
| CAS Number | 62033-50-5 | Molecular Weight | 316.23400 | |
| Density | N/A | Boiling Point | 381.9ºC at 760 mmHg | |
| Molecular Formula | C14H22BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 381.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H22BrNO2 |
| Molecular Weight | 316.23400 |
| Flash Point | 190.3ºC |
| Exact Mass | 315.08300 |
| PSA | 43.70000 |
| LogP | 3.58320 |
| InChIKey | MGQCEDFCXUPVBL-UHFFFAOYSA-N |
| SMILES | Br.CCCN1CCCC(c2ccc(O)c(O)c2)C1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![1-[3-(3,4-dimethoxyphenyl)piperidin-1-yl]propan-1-one structure](https://image.chemsrc.com/caspic/181/62033-62-9.png)
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Dopamine receptor activation in limbic system of reserpinized rat
Source: ChEMBL
Target: D(2) dopamine receptor
External Id: CHEMBL670602
|
|
Name: Motor activity in reserpinized rats when 100 umol/kg was administered subcutaneously
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL793941
|
|
Name: Evaluation for Dopamine receptor activation in striatum of reserpinized rat.
Source: ChEMBL
Target: D(2) dopamine receptor
External Id: CHEMBL670607
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2-Benzenediol,4-(1-propyl-3-piperidinyl)-,hydrobromide |
| 3-(3,4-dihydroxyphenyl)-N-n-propylpiperidine |
| 4-(1-Propyl-3-piperidinyl)-1,2-benzenediol hydrobromide |
| 4-(1-propylpiperidin-3-yl)benzene-1,2-diol hydrobromide |
| N-propyl-3-(3',4'-dihydroxyphenyl)-piperidine hydrobromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide? |
| A: Molecular weight of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide is 316.23400. |
| Q: What English synonyms does 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide have? |
| A: English synonyms of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide: 1,2-Benzenediol,4-(1-propyl-3-piperidinyl)-,hydrobromide, 3-(3,4-dihydroxyphenyl)-N-n-propylpiperidine, 4-(1-Propyl-3-piperidinyl)-1,2-benzenediol hydrobromide, 4-(1-propylpiperidin-3-yl)benzene-1,2-diol hydrobromide, N-propyl-3-(3',4'-dihydroxyphenyl)-piperidine hydrobromide. |
| Q: What is the English name of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide? |
| A: The English name of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide is 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide. |
| Q: What is the molecular formula of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide? |
| A: Molecular formula of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide is C14H22BrNO2. |
| Q: What is the CAS number of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide? |
| A: CAS number of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide is 62033-50-5. |
| Q: What is the boiling point of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide? |
| A: Boiling point of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide is 381.9ºC at 760 mmHg. |
| Q: What is the SMILES notation of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide? |
| A: SMILES notation of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide is Br.CCCN1CCCC(c2ccc(O)c(O)c2)C1. |
| Q: What is the polar surface area (PSA) of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide? |
| A: Polar surface area (PSA) of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide is 43.70000. |
| Q: What is the Chinese name of 62033-50-5? |
| A: Chinese name of 62033-50-5 is 62033-50-5. |
| Q: What is the InChIKey of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide? |
| A: InChIKey of 4-(1-propylpiperidin-3-yl)benzene-1,2-diol,hydrobromide is MGQCEDFCXUPVBL-UHFFFAOYSA-N. |