ethyl 3-(4-iodoanilino)-3-oxopropanoate structure
|
Common Name | ethyl 3-(4-iodoanilino)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 62033-65-2 | Molecular Weight | 333.12200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-(4-iodoanilino)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12INO3 |
|---|---|
| Molecular Weight | 333.12200 |
| Exact Mass | 332.98600 |
| PSA | 55.40000 |
| LogP | 2.25590 |
| InChIKey | ATHLKCCNVLBJDJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)Nc1ccc(I)cc1 |
|
~%
ethyl 3-(4-iodo... CAS#:62033-65-2 |
| Literature: Chattaway; Constable Journal of the Chemical Society, 1914 , vol. 105, p. 127 |
|
~%
ethyl 3-(4-iodo... CAS#:62033-65-2 |
| Literature: Chattaway; Constable Journal of the Chemical Society, 1914 , vol. 105, p. 127 |
| Ethyl-malon-p-iodanilat |
| N-(4-iodo-phenyl)-malonamic acid ethyl ester |
| Propanoic acid,3-[(4-iodophenyl)amino]-3-oxo-,ethyl ester |
| Malonsaeure-aethylester-(4-jod-anilid) |
| N-(4-Jod-phenyl)-malonamidsaeure-aethylester |