2-[(4-azidophenyl)methyl]isoindole-1,3-dione structure
|
Common Name | 2-[(4-azidophenyl)methyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 62133-08-8 | Molecular Weight | 278.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(4-azidophenyl)methyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10N4O2 |
|---|---|
| Molecular Weight | 278.26600 |
| Exact Mass | 278.08000 |
| PSA | 87.13000 |
| LogP | 2.81526 |
| InChIKey | BNXRYUXAEVYXNL-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1ccc(CN2C(=O)c3ccccc3C2=O)cc1 |
|
~89%
2-[(4-azidophen... CAS#:62133-08-8 |
| Literature: Wombacher, Richard; Jaechke, Andres Journal of the American Chemical Society, 2008 , vol. 130, # 27 p. 8594 - 8595 |
| 1H-Isoindole-1,3(2H)-dione,2-[(4-azidophenyl)methyl] |