(S)-3-(BOC-AMINO)-2-OXO-1-AZEPINE-ACETICACID structure
|
Common Name | (S)-3-(BOC-AMINO)-2-OXO-1-AZEPINE-ACETICACID | ||
|---|---|---|---|---|
| CAS Number | 6214-20-6 | Molecular Weight | 217.19900 | |
| Density | 1.453g/cm3 | Boiling Point | 364.2ºC at 760 mmHg | |
| Molecular Formula | C7H7NO5S | Melting Point | 89-92ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 174ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | methyl 4-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 364.2ºC at 760 mmHg |
| Melting Point | 89-92ºC(lit.) |
| Molecular Formula | C7H7NO5S |
| Molecular Weight | 217.19900 |
| Flash Point | 174ºC |
| Exact Mass | 217.00400 |
| PSA | 97.57000 |
| LogP | 2.53390 |
| Index of Refraction | 1.555 |
| InChIKey | RMNJNEUWTBBZPT-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| Precursor 8 | |
|---|---|
| DownStream 8 | |
| HS Code | 2905199090 |
|---|---|
| Summary | 2905199090. saturated monohydric alcohols. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Inhibition of inositol 1,3,4-trisphosphate 5/6-kinase by amino acid modifying agents.
Biochem. Soc. Trans. 21(4) , 365S, (1993)
|
|
|
Study of the reaction between methyl 4-nitrobenzenesulfonate and bromide ions in mixed single-chain-gemini micellar solutions: kinetic evidence for morphological transitions.
J. Colloid. Interface Sci. 328(2) , 324-30, (2008) The reaction between methyl 4-nitrobenzenesulfonate and bromide ions has been studied in mixed single-chain-gemini micellar solutions of n-dodecyltrimethylammonium bromide, DTAB, and dodecyl tricosaox... |
|
|
The chemical modification of Escherichia coli ribosomes with methyl p-nitrobenzenesulfonate. Evidence for the involvement of a histidine residue in the functioning of the ribosomal peptidyl transferase.
Can. J. Biochem. 58 , 1345, (1980)
|
| methyl p-nitrobenzenesulphonate |
| methyl p-nitrobenzensulfonate |
| Methyl 4-nitrobenzenesulphonate |
| p-nitrobenzenesulfonic acid methyl ester |
| Benzenesulfonic acid,4-nitro-,methyl ester |
| Methyl-4-nitrobenzenesulfonate |
| EINECS 228-282-2 |
| methyl p-nosylate |
| methyl nitrobenzene-p-sulphonate |
| MFCD00007344 |
| methyl p-nitrobenzenesulfonate |