Trimethyloxonium hexafluorophosphate structure
|
Common Name | Trimethyloxonium hexafluorophosphate | ||
|---|---|---|---|---|
| CAS Number | 12116-05-1 | Molecular Weight | 206.06700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3H9F6OP------ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyloxidanium,hexafluorophosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C3H9F6OP------ |
|---|---|
| Molecular Weight | 206.06700 |
| Exact Mass | 206.03000 |
| PSA | 22.82000 |
| InChIKey | GARJBAQVHHSPGF-UHFFFAOYSA-N |
| SMILES | C[O+](C)C.F[P-](F)(F)(F)(F)F |
|
~42%
Trimethyloxoniu... CAS#:12116-05-1 |
| Literature: Olah, George A.; Burrichter, Arwed; Rasul, Golam; Gnann, Robert; Christe, Karl O.; Prakash, G. K. Surya Journal of the American Chemical Society, 1997 , vol. 119, # 34 p. 8035 - 8042 |
|
~%
Trimethyloxoniu... CAS#:12116-05-1 |
| Literature: Olah,G.A. et al. Synthesis, 1973 , p. 490 - 492 |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| Trimethyloxonium hexafluorophosphate |
| EINECS 235-174-9 |
| trimethyloxidanium hexafluorophosphate |